C21H30O6 — CID 163882246
2-ethoxycarbonyloxypropan-2-yl (2S)-2-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoate (PubChem CID 163882246) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-ethoxycarbonyloxypropan-2-yl (2S)-2-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoate.
| Compound Name | 2-ethoxycarbonyloxypropan-2-yl (2S)-2-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 163882246 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-ethoxycarbonyloxypropan-2-yl (2S)-2-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)OC(C)(C)OC(=O)[C@@H](C)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H30O6/c1-5-25-20(24)27-21(3,4)26-19(23)14(2)16-11-9-15(10-12-16)13-17-7-6-8-18(17)22/h9-12,14,17-18,22H,5-8,13H2,1-4H3/t14-,17+,18-/m0/s1 |
| InChIKey | PUGHLFWSIXNXPB-QGTPRVQTSA-N |
| XLogP | 3.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|