About (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one
(3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one (PubChem CID 167002857) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one.
Molecular Properties
| Compound Name | (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one |
| PubChem CID | 167002857 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one |
| SMILES | CC(=O)[C@@H](C)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H22O2/c1-11(12(2)17)14-8-6-13(7-9-14)10-15-4-3-5-16(15)18/h6-9,11,15-16,18H,3-5,10H2,1-2H3/t11-,15-,16+/m1/s1 |
| InChIKey | GTAOGFYAXCRFKU-LYRGGWFBSA-N |
| XLogP | 3.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one?
The IUPAC name of (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one (CID 167002857) is (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one.
What is the SMILES notation for (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one?
The canonical SMILES for (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one is CC(=O)[C@@H](C)c1ccc(C[C@H]2CCC[C@@H]2O)cc1.
What is the InChIKey of (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one?
The InChIKey is GTAOGFYAXCRFKU-LYRGGWFBSA-N. The full InChI is InChI=1S/C16H22O2/c1-11(12(2)17)14-8-6-13(7-9-14)10-15-4-3-5-16(15)18/h6-9,11,15-16,18H,3-5,10H2,1-2H3/t11-,15-,16+/m1/s1.
What are the key properties of (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one?
(3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one has a molecular weight of 246.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]butan-2-one is sourced from PubChem (CID 167002857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).