About cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate
cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate (PubChem CID 164936777) has the molecular formula C26H38O5
and a molecular weight of 430.59 g/mol. Its IUPAC name is cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate.
Molecular Properties
| Compound Name | cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate |
| PubChem CID | 164936777 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate |
| SMILES | C[C@H](C(=O)CC(C)(C)OC(=O)OC1CCCCC1)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C26H38O5/c1-18(20-14-12-19(13-15-20)16-21-8-7-11-23(21)27)24(28)17-26(2,3)31-25(29)30-22-9-5-4-6-10-22/h12-15,18,21-23,27H,4-11,16-17H2,1-3H3/t18-,21+,23-/m0/s1 |
| InChIKey | GFSIMHLBOLEVOL-ZEYPLWLESA-N |
| XLogP | 5.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate?
The IUPAC name of cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate (CID 164936777) is cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate.
What is the SMILES notation for cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate?
The canonical SMILES for cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate is C[C@H](C(=O)CC(C)(C)OC(=O)OC1CCCCC1)c1ccc(C[C@H]2CCC[C@@H]2O)cc1.
What is the InChIKey of cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate?
The InChIKey is GFSIMHLBOLEVOL-ZEYPLWLESA-N. The full InChI is InChI=1S/C26H38O5/c1-18(20-14-12-19(13-15-20)16-21-8-7-11-23(21)27)24(28)17-26(2,3)31-25(29)30-22-9-5-4-6-10-22/h12-15,18,21-23,27H,4-11,16-17H2,1-3H3/t18-,21+,23-/m0/s1.
What are the key properties of cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate?
cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate has a molecular weight of 430.59 g/mol, XLogP of 5.72, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl [(5S)-5-[4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]-2-methyl-4-oxohexan-2-yl] carbonate is sourced from PubChem (CID 164936777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).