About 2-chloropropan-2-yl cyclohexyl carbonate
2-chloropropan-2-yl cyclohexyl carbonate (PubChem CID 163283556) has the molecular formula C10H17ClO3
and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-chloropropan-2-yl cyclohexyl carbonate.
Molecular Properties
| Compound Name | 2-chloropropan-2-yl cyclohexyl carbonate |
| PubChem CID | 163283556 |
| Molecular Formula | C10H17ClO3 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-chloropropan-2-yl cyclohexyl carbonate |
| SMILES | CC(C)(Cl)OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H17ClO3/c1-10(2,11)14-9(12)13-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3 |
| InChIKey | JUGUXTMVPUVANV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropan-2-yl cyclohexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropan-2-yl cyclohexyl carbonate?
The IUPAC name of 2-chloropropan-2-yl cyclohexyl carbonate (CID 163283556) is 2-chloropropan-2-yl cyclohexyl carbonate.
What is the SMILES notation for 2-chloropropan-2-yl cyclohexyl carbonate?
The canonical SMILES for 2-chloropropan-2-yl cyclohexyl carbonate is CC(C)(Cl)OC(=O)OC1CCCCC1.
What is the InChIKey of 2-chloropropan-2-yl cyclohexyl carbonate?
The InChIKey is JUGUXTMVPUVANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClO3/c1-10(2,11)14-9(12)13-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3.
What are the key properties of 2-chloropropan-2-yl cyclohexyl carbonate?
2-chloropropan-2-yl cyclohexyl carbonate has a molecular weight of 220.70 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropan-2-yl cyclohexyl carbonate is sourced from PubChem (CID 163283556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).