About cyclooctyl carbonochloridate;ethane
cyclooctyl carbonochloridate;ethane (PubChem CID 144532416) has the molecular formula C11H21ClO2
and a molecular weight of 220.74 g/mol. Its IUPAC name is cyclooctyl carbonochloridate;ethane.
Molecular Properties
| Compound Name | cyclooctyl carbonochloridate;ethane |
| PubChem CID | 144532416 |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | cyclooctyl carbonochloridate;ethane |
| SMILES | CC.O=C(Cl)OC1CCCCCCC1 |
| InChI | InChI=1S/C9H15ClO2.C2H6/c10-9(11)12-8-6-4-2-1-3-5-7-8;1-2/h8H,1-7H2;1-2H3 |
| InChIKey | FLCRUTVMCJCXES-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze cyclooctyl carbonochloridate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctyl carbonochloridate;ethane?
The IUPAC name of cyclooctyl carbonochloridate;ethane (CID 144532416) is cyclooctyl carbonochloridate;ethane.
What is the SMILES notation for cyclooctyl carbonochloridate;ethane?
The canonical SMILES for cyclooctyl carbonochloridate;ethane is CC.O=C(Cl)OC1CCCCCCC1.
What is the InChIKey of cyclooctyl carbonochloridate;ethane?
The InChIKey is FLCRUTVMCJCXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO2.C2H6/c10-9(11)12-8-6-4-2-1-3-5-7-8;1-2/h8H,1-7H2;1-2H3.
What are the key properties of cyclooctyl carbonochloridate;ethane?
cyclooctyl carbonochloridate;ethane has a molecular weight of 220.74 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctyl carbonochloridate;ethane is sourced from PubChem (CID 144532416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).