About tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate)
tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) (PubChem CID 159925265) has the molecular formula C31H58O6
and a molecular weight of 526.80 g/mol. Its IUPAC name is tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate).
Molecular Properties
| Compound Name | tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) |
| PubChem CID | 159925265 |
| Molecular Formula | C31H58O6 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.42 |
| IUPAC Name | tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) |
| SMILES | CC(C)(C)C(=O)OC1CCCCC1.CC(C)(C)C(=O)OC1CCCCC1.CC(C)(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/2C11H20O2.C9H18O2/c2*1-11(2,3)10(12)13-9-7-5-4-6-8-9;1-8(2,3)7(10)11-9(4,5)6/h2*9H,4-8H2,1-3H3;1-6H3 |
| InChIKey | NYXWMJLPNYEPKA-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate)?
The IUPAC name of tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) (CID 159925265) is tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate).
What is the SMILES notation for tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate)?
The canonical SMILES for tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) is CC(C)(C)C(=O)OC1CCCCC1.CC(C)(C)C(=O)OC1CCCCC1.CC(C)(C)OC(=O)C(C)(C)C.
What is the InChIKey of tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate)?
The InChIKey is NYXWMJLPNYEPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H20O2.C9H18O2/c2*1-11(2,3)10(12)13-9-7-5-4-6-8-9;1-8(2,3)7(10)11-9(4,5)6/h2*9H,4-8H2,1-3H3;1-6H3.
What are the key properties of tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate)?
tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) has a molecular weight of 526.80 g/mol, XLogP of 8.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2-dimethylpropanoate;bis(cyclohexyl 2,2-dimethylpropanoate) is sourced from PubChem (CID 159925265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).