About (1-chloro-1-iodoethyl) cyclohexyl carbonate
(1-chloro-1-iodoethyl) cyclohexyl carbonate (PubChem CID 69058507) has the molecular formula C9H14ClIO3
and a molecular weight of 332.57 g/mol. Its IUPAC name is (1-chloro-1-iodoethyl) cyclohexyl carbonate.
Molecular Properties
| Compound Name | (1-chloro-1-iodoethyl) cyclohexyl carbonate |
| PubChem CID | 69058507 |
| Molecular Formula | C9H14ClIO3 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | (1-chloro-1-iodoethyl) cyclohexyl carbonate |
| SMILES | CC(Cl)(I)OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C9H14ClIO3/c1-9(10,11)14-8(12)13-7-5-3-2-4-6-7/h7H,2-6H2,1H3 |
| InChIKey | GTXRNLLEMPLTAQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-1-iodoethyl) cyclohexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-1-iodoethyl) cyclohexyl carbonate?
The IUPAC name of (1-chloro-1-iodoethyl) cyclohexyl carbonate (CID 69058507) is (1-chloro-1-iodoethyl) cyclohexyl carbonate.
What is the SMILES notation for (1-chloro-1-iodoethyl) cyclohexyl carbonate?
The canonical SMILES for (1-chloro-1-iodoethyl) cyclohexyl carbonate is CC(Cl)(I)OC(=O)OC1CCCCC1.
What is the InChIKey of (1-chloro-1-iodoethyl) cyclohexyl carbonate?
The InChIKey is GTXRNLLEMPLTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClIO3/c1-9(10,11)14-8(12)13-7-5-3-2-4-6-7/h7H,2-6H2,1H3.
What are the key properties of (1-chloro-1-iodoethyl) cyclohexyl carbonate?
(1-chloro-1-iodoethyl) cyclohexyl carbonate has a molecular weight of 332.57 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-1-iodoethyl) cyclohexyl carbonate is sourced from PubChem (CID 69058507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).