C15H20O4 — CID 131668289
2-[4-[(2,4-dihydroxycyclopentyl)methyl]phenyl]propanoic acid (PubChem CID 131668289) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[4-[(2,4-dihydroxycyclopentyl)methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(2,4-dihydroxycyclopentyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 131668289 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[4-[(2,4-dihydroxycyclopentyl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CC2CC(O)CC2O)cc1 |
| InChI | InChI=1S/C15H20O4/c1-9(15(18)19)11-4-2-10(3-5-11)6-12-7-13(16)8-14(12)17/h2-5,9,12-14,16-17H,6-8H2,1H3,(H,18,19) |
| InChIKey | COCTZXJHZDMRKU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |