C15H27NO — CID 143458427
(2E,4Z)-N-ethyl-6,7-dimethylocta-2,4,6-trien-3-amine;propan-2-one (PubChem CID 143458427) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2E,4Z)-N-ethyl-6,7-dimethylocta-2,4,6-trien-3-amine;propan-2-one.
| Compound Name | (2E,4Z)-N-ethyl-6,7-dimethylocta-2,4,6-trien-3-amine;propan-2-one |
|---|---|
| PubChem CID | 143458427 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2E,4Z)-N-ethyl-6,7-dimethylocta-2,4,6-trien-3-amine;propan-2-one |
| SMILES | C/C=C(\C=C/C(C)=C(C)C)NCC.CC(C)=O |
| InChI | InChI=1S/C12H21N.C3H6O/c1-6-12(13-7-2)9-8-11(5)10(3)4;1-3(2)4/h6,8-9,13H,7H2,1-5H3;1-2H3/b9-8-,12-6+; |
| InChIKey | SDHLVRZVOLLWBE-GZORPPJASA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|