C12H21N — CID 143915621
(2E,4Z)-N-butyl-6-methylhepta-2,4,6-trien-3-amine (PubChem CID 143915621) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E,4Z)-N-butyl-6-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-butyl-6-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143915621 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E,4Z)-N-butyl-6-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C=C\C(=C/C)NCCCC |
| InChI | InChI=1S/C12H21N/c1-5-7-10-13-12(6-2)9-8-11(3)4/h6,8-9,13H,3,5,7,10H2,1-2,4H3/b9-8-,12-6- |
| InChIKey | JPMCFYQYNMELDN-GNXJPQOPSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|