C8H20N2 — CID 159003501
1-N'-butyl-1-N-methylethene-1,1-diamine;methane (PubChem CID 159003501) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is 1-N'-butyl-1-N-methylethene-1,1-diamine;methane.
| Compound Name | 1-N'-butyl-1-N-methylethene-1,1-diamine;methane |
|---|---|
| PubChem CID | 159003501 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 1-N'-butyl-1-N-methylethene-1,1-diamine;methane |
| SMILES | C.C=C(NC)NCCCC |
| InChI | InChI=1S/C7H16N2.CH4/c1-4-5-6-9-7(2)8-3;/h8-9H,2,4-6H2,1,3H3;1H4 |
| InChIKey | JRQBZXGLPPYDBV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|