C13H26N2 — CID 144572732
(3Z)-4-N-butyl-2-N,2-N-diethylpenta-1,3-diene-2,4-diamine (PubChem CID 144572732) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (3Z)-4-N-butyl-2-N,2-N-diethylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-4-N-butyl-2-N,2-N-diethylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 144572732 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (3Z)-4-N-butyl-2-N,2-N-diethylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(/C=C(/C)NCCCC)N(CC)CC |
| InChI | InChI=1S/C13H26N2/c1-6-9-10-14-12(4)11-13(5)15(7-2)8-3/h11,14H,5-10H2,1-4H3/b12-11- |
| InChIKey | NMRDTRBODSAUFB-QXMHVHEDSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|