C11H19NO — CID 121220213
(3E)-4-(diethylamino)-5-methylhexa-3,5-dien-2-one (PubChem CID 121220213) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3E)-4-(diethylamino)-5-methylhexa-3,5-dien-2-one.
| Compound Name | (3E)-4-(diethylamino)-5-methylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 121220213 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3E)-4-(diethylamino)-5-methylhexa-3,5-dien-2-one |
| SMILES | C=C(C)/C(=C\C(C)=O)N(CC)CC |
| InChI | InChI=1S/C11H19NO/c1-6-12(7-2)11(9(3)4)8-10(5)13/h8H,3,6-7H2,1-2,4-5H3/b11-8+ |
| InChIKey | MTRAXYMMWJIYPD-DHZHZOJOSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|