C9H14F3NO — CID 2752549
N,N-diethyl-4,4,4-trifluoro-3-methylbut-2-enamide (PubChem CID 2752549) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is N,N-diethyl-4,4,4-trifluoro-3-methylbut-2-enamide.
| Compound Name | N,N-diethyl-4,4,4-trifluoro-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 2752549 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N,N-diethyl-4,4,4-trifluoro-3-methylbut-2-enamide |
| SMILES | CCN(CC)C(=O)C=C(C)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c1-4-13(5-2)8(14)6-7(3)9(10,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | LMOUYGLJWFMUGA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|