C10H16F3NO2 — CID 124647789
(Z)-4-(diethylamino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one (PubChem CID 124647789) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is (Z)-4-(diethylamino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (Z)-4-(diethylamino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 124647789 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (Z)-4-(diethylamino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CCO/C(=C\C(=O)C(F)(F)F)N(CC)CC |
| InChI | InChI=1S/C10H16F3NO2/c1-4-14(5-2)9(16-6-3)7-8(15)10(11,12)13/h7H,4-6H2,1-3H3/b9-7- |
| InChIKey | ZXIRRDYHLAQPTP-CLFYSBASSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|