C14H25NO3 — CID 134921708
(E)-1-(dimethylamino)-1-ethoxy-4,4,6-trimethylhept-1-ene-3,5-dione (PubChem CID 134921708) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (E)-1-(dimethylamino)-1-ethoxy-4,4,6-trimethylhept-1-ene-3,5-dione.
| Compound Name | (E)-1-(dimethylamino)-1-ethoxy-4,4,6-trimethylhept-1-ene-3,5-dione |
|---|---|
| PubChem CID | 134921708 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (E)-1-(dimethylamino)-1-ethoxy-4,4,6-trimethylhept-1-ene-3,5-dione |
| SMILES | CCO/C(=C/C(=O)C(C)(C)C(=O)C(C)C)N(C)C |
| InChI | InChI=1S/C14H25NO3/c1-8-18-12(15(6)7)9-11(16)14(4,5)13(17)10(2)3/h9-10H,8H2,1-7H3/b12-9+ |
| InChIKey | RAQWKJCFBGOKFW-FMIVXFBMSA-N |
| XLogP | 2.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|