C10H20N2O8 — CID 88603855
azane;ethyl 4-amino-2-hydroxy-2-methyl-3-oxopentanoate;oxalic acid (PubChem CID 88603855) has the molecular formula C10H20N2O8 and a molecular weight of 296.28 g/mol. Its IUPAC name is azane;ethyl 4-amino-2-hydroxy-2-methyl-3-oxopentanoate;oxalic acid.
| Compound Name | azane;ethyl 4-amino-2-hydroxy-2-methyl-3-oxopentanoate;oxalic acid |
|---|---|
| PubChem CID | 88603855 |
| Molecular Formula | C10H20N2O8 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | azane;ethyl 4-amino-2-hydroxy-2-methyl-3-oxopentanoate;oxalic acid |
| SMILES | CCOC(=O)C(C)(O)C(=O)C(C)N.N.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H15NO4.C2H2O4.H3N/c1-4-13-7(11)8(3,12)6(10)5(2)9;3-1(4)2(5)6;/h5,12H,4,9H2,1-3H3;(H,3,4)(H,5,6);1H3 |
| InChIKey | RSQIYJIJZUKUAJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 199.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|