C15H31BF4N2O2 — CID 134873214
[(E)-3-(diethylamino)-1,3-diethoxyprop-2-enylidene]-diethylazanium tetrafluoroborate (PubChem CID 134873214) has the molecular formula C15H31BF4N2O2 and a molecular weight of 358.23 g/mol. Its IUPAC name is [(E)-3-(diethylamino)-1,3-diethoxyprop-2-enylidene]-diethylazanium tetrafluoroborate.
| Compound Name | [(E)-3-(diethylamino)-1,3-diethoxyprop-2-enylidene]-diethylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 134873214 |
| Molecular Formula | C15H31BF4N2O2 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [(E)-3-(diethylamino)-1,3-diethoxyprop-2-enylidene]-diethylazanium tetrafluoroborate |
| SMILES | CCOC(/C=C(/OCC)N(CC)CC)=[N+](CC)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C15H31N2O2.BF4/c1-7-16(8-2)14(18-11-5)13-15(19-12-6)17(9-3)10-4;2-1(3,4)5/h13H,7-12H2,1-6H3;/q+1;-1 |
| InChIKey | XWBWADHKRONJHW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|