C10H11F3O4 — CID 170661182
ethyl (E,2Z)-6,6,6-trifluoro-2-(1-hydroxyethylidene)-5-oxohex-3-enoate (PubChem CID 170661182) has the molecular formula C10H11F3O4 and a molecular weight of 252.19 g/mol. Its IUPAC name is ethyl (E,2Z)-6,6,6-trifluoro-2-(1-hydroxyethylidene)-5-oxohex-3-enoate.
| Compound Name | ethyl (E,2Z)-6,6,6-trifluoro-2-(1-hydroxyethylidene)-5-oxohex-3-enoate |
|---|---|
| PubChem CID | 170661182 |
| Molecular Formula | C10H11F3O4 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | ethyl (E,2Z)-6,6,6-trifluoro-2-(1-hydroxyethylidene)-5-oxohex-3-enoate |
| SMILES | CCOC(=O)C(/C=C/C(=O)C(F)(F)F)=C(/C)O |
| InChI | InChI=1S/C10H11F3O4/c1-3-17-9(16)7(6(2)14)4-5-8(15)10(11,12)13/h4-5,14H,3H2,1-2H3/b5-4+,7-6- |
| InChIKey | MOSXPKRBCFJETN-DEQVHDEQSA-N |
| XLogP | 2.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|