C12H14F6O4 — CID 159823844
4-ethoxy-1,1,1-trifluorobut-3-en-2-one (PubChem CID 159823844) has the molecular formula C12H14F6O4 and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-ethoxy-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 159823844 |
| Molecular Formula | C12H14F6O4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CCOC=CC(=O)C(F)(F)F.CCOC=CC(=O)C(F)(F)F |
| InChI | InChI=1S/2C6H7F3O2/c2*1-2-11-4-3-5(10)6(7,8)9/h2*3-4H,2H2,1H3 |
| InChIKey | NMORVCUGEZIBKI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|