C7H7ClF4O2 — CID 123496761
4-chloro-1-ethoxy-4,5,5,5-tetrafluoropent-1-en-3-one (PubChem CID 123496761) has the molecular formula C7H7ClF4O2 and a molecular weight of 234.58 g/mol. Its IUPAC name is 4-chloro-1-ethoxy-4,5,5,5-tetrafluoropent-1-en-3-one.
| Compound Name | 4-chloro-1-ethoxy-4,5,5,5-tetrafluoropent-1-en-3-one |
|---|---|
| PubChem CID | 123496761 |
| Molecular Formula | C7H7ClF4O2 |
| Molecular Weight | 234.58 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 4-chloro-1-ethoxy-4,5,5,5-tetrafluoropent-1-en-3-one |
| SMILES | CCOC=CC(=O)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7H7ClF4O2/c1-2-14-4-3-5(13)6(8,9)7(10,11)12/h3-4H,2H2,1H3 |
| InChIKey | RFGVXVLFLIWJKJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|