C9H7N3O — CID 100972229
(3E)-4-ethoxybuta-1,3-diene-1,1,2-tricarbonitrile (PubChem CID 100972229) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is (3E)-4-ethoxybuta-1,3-diene-1,1,2-tricarbonitrile.
| Compound Name | (3E)-4-ethoxybuta-1,3-diene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 100972229 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (3E)-4-ethoxybuta-1,3-diene-1,1,2-tricarbonitrile |
| SMILES | CCO/C=C/C(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C9H7N3O/c1-2-13-4-3-8(5-10)9(6-11)7-12/h3-4H,2H2,1H3/b4-3+ |
| InChIKey | RXHYVZBNGQQBOP-ONEGZZNKSA-N |
| XLogP | 1.40 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|