ethanol;3-ethoxyprop-2-enoic acid

C9H20O5 — CID 173050245

IUPACethanol;3-ethoxyprop-2-enoic acid
SMILESCCO.CCO.CCOC=CC(=O)O
InChIInChI=1S/C5H8O3.2C2H6O/c1-2-8-4-3-5(6)7;2*1-2-3/h3-4H,2H2,1H3,(H,6,7);2*3H,2H2,1H3
InChIKeyKRJTZDLBLMCITJ-UHFFFAOYSA-N
MW208.25 g/mol
LogP0.62
Rot. Bonds3

About ethanol;3-ethoxyprop-2-enoic acid

ethanol;3-ethoxyprop-2-enoic acid (PubChem CID 173050245) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is ethanol;3-ethoxyprop-2-enoic acid.

Molecular Properties

Compound Nameethanol;3-ethoxyprop-2-enoic acid
PubChem CID173050245
Molecular FormulaC9H20O5
Molecular Weight208.25 g/mol
Exact Mass208.13
IUPAC Nameethanol;3-ethoxyprop-2-enoic acid
SMILESCCO.CCO.CCOC=CC(=O)O
InChIInChI=1S/C5H8O3.2C2H6O/c1-2-8-4-3-5(6)7;2*1-2-3/h3-4H,2H2,1H3,(H,6,7);2*3H,2H2,1H3
InChIKeyKRJTZDLBLMCITJ-UHFFFAOYSA-N
XLogP0.62
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.25
LogP ≤ 50.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethanol;3-ethoxyprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethanol;3-ethoxyprop-2-enoic acid?
The IUPAC name of ethanol;3-ethoxyprop-2-enoic acid (CID 173050245) is ethanol;3-ethoxyprop-2-enoic acid.
What is the SMILES notation for ethanol;3-ethoxyprop-2-enoic acid?
The canonical SMILES for ethanol;3-ethoxyprop-2-enoic acid is CCO.CCO.CCOC=CC(=O)O.
What is the InChIKey of ethanol;3-ethoxyprop-2-enoic acid?
The InChIKey is KRJTZDLBLMCITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.2C2H6O/c1-2-8-4-3-5(6)7;2*1-2-3/h3-4H,2H2,1H3,(H,6,7);2*3H,2H2,1H3.
What are the key properties of ethanol;3-ethoxyprop-2-enoic acid?
ethanol;3-ethoxyprop-2-enoic acid has a molecular weight of 208.25 g/mol, XLogP of 0.62, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;3-ethoxyprop-2-enoic acid is sourced from PubChem (CID 173050245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).