C11H22O6 — CID 173272341
2,2-dimethyl-3-methylperoxypropan-1-ol;3-ethoxyprop-2-enoic acid (PubChem CID 173272341) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2,2-dimethyl-3-methylperoxypropan-1-ol;3-ethoxyprop-2-enoic acid.
| Compound Name | 2,2-dimethyl-3-methylperoxypropan-1-ol;3-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173272341 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2,2-dimethyl-3-methylperoxypropan-1-ol;3-ethoxyprop-2-enoic acid |
| SMILES | CCOC=CC(=O)O.COOCC(C)(C)CO |
| InChI | InChI=1S/C6H14O3.C5H8O3/c1-6(2,4-7)5-9-8-3;1-2-8-4-3-5(6)7/h7H,4-5H2,1-3H3;3-4H,2H2,1H3,(H,6,7) |
| InChIKey | VUEGDCHAVUJGOS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|