ethanol;3-ethoxyprop-2-enoic acid

C23H62O12 — CID 173210904

IUPACethanol;3-ethoxyprop-2-enoic acid
SMILESCCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOC=CC(=O)O
InChIInChI=1S/C5H8O3.9C2H6O/c1-2-8-4-3-5(6)7;9*1-2-3/h3-4H,2H2,1H3,(H,6,7);9*3H,2H2,1H3
InChIKeyAKEIVEIWJRPIBQ-UHFFFAOYSA-N
MW530.74 g/mol
LogP0.61
Rot. Bonds3

About ethanol;3-ethoxyprop-2-enoic acid

ethanol;3-ethoxyprop-2-enoic acid (PubChem CID 173210904) has the molecular formula C23H62O12 and a molecular weight of 530.74 g/mol. Its IUPAC name is ethanol;3-ethoxyprop-2-enoic acid.

Molecular Properties

Compound Nameethanol;3-ethoxyprop-2-enoic acid
PubChem CID173210904
Molecular FormulaC23H62O12
Molecular Weight530.74 g/mol
Exact Mass530.42
IUPAC Nameethanol;3-ethoxyprop-2-enoic acid
SMILESCCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOC=CC(=O)O
InChIInChI=1S/C5H8O3.9C2H6O/c1-2-8-4-3-5(6)7;9*1-2-3/h3-4H,2H2,1H3,(H,6,7);9*3H,2H2,1H3
InChIKeyAKEIVEIWJRPIBQ-UHFFFAOYSA-N
XLogP0.61
TPSA228.60 Ų
H-Bond Donors10
H-Bond Acceptors11
Rotatable Bonds3
Heavy Atoms35
Complexity—

Lipinski Rule of Five

3 violations

RuleValue
MW ≤ 500530.74
LogP ≤ 50.61
H-Bond Donors ≤ 510
H-Bond Acceptors ≤ 1011

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethanol;3-ethoxyprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethanol;3-ethoxyprop-2-enoic acid?
The IUPAC name of ethanol;3-ethoxyprop-2-enoic acid (CID 173210904) is ethanol;3-ethoxyprop-2-enoic acid.
What is the SMILES notation for ethanol;3-ethoxyprop-2-enoic acid?
The canonical SMILES for ethanol;3-ethoxyprop-2-enoic acid is CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCO.CCOC=CC(=O)O.
What is the InChIKey of ethanol;3-ethoxyprop-2-enoic acid?
The InChIKey is AKEIVEIWJRPIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.9C2H6O/c1-2-8-4-3-5(6)7;9*1-2-3/h3-4H,2H2,1H3,(H,6,7);9*3H,2H2,1H3.
What are the key properties of ethanol;3-ethoxyprop-2-enoic acid?
ethanol;3-ethoxyprop-2-enoic acid has a molecular weight of 530.74 g/mol, XLogP of 0.61, 3 rotatable bonds, 10 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;3-ethoxyprop-2-enoic acid is sourced from PubChem (CID 173210904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).