C11H9Cl2FO2 — CID 76951333
1-(2,6-dichloro-3-fluorophenyl)-3-ethoxyprop-2-en-1-one (PubChem CID 76951333) has the molecular formula C11H9Cl2FO2 and a molecular weight of 263.10 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)-3-ethoxyprop-2-en-1-one.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)-3-ethoxyprop-2-en-1-one |
|---|---|
| PubChem CID | 76951333 |
| Molecular Formula | C11H9Cl2FO2 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)-3-ethoxyprop-2-en-1-one |
| SMILES | CCOC=CC(=O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C11H9Cl2FO2/c1-2-16-6-5-9(15)10-7(12)3-4-8(14)11(10)13/h3-6H,2H2,1H3 |
| InChIKey | IFVPZJMWPFHYGP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|