C12H19NO — CID 156853441
(3Z)-N,N-diethyl-5-methyl-2-methylidenehexa-3,5-dienamide (PubChem CID 156853441) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3Z)-N,N-diethyl-5-methyl-2-methylidenehexa-3,5-dienamide.
| Compound Name | (3Z)-N,N-diethyl-5-methyl-2-methylidenehexa-3,5-dienamide |
|---|---|
| PubChem CID | 156853441 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3Z)-N,N-diethyl-5-methyl-2-methylidenehexa-3,5-dienamide |
| SMILES | C=C(C)/C=C\C(=C)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H19NO/c1-6-13(7-2)12(14)11(5)9-8-10(3)4/h8-9H,3,5-7H2,1-2,4H3/b9-8- |
| InChIKey | LBNNYFPCDVFFMH-HJWRWDBZSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|