C21H26 — CID 144536810
(3Z,7Z,12Z)-2,14-dimethyl-5,6,10,11-tetramethylidenepentadeca-1,3,7,12,14-pentaene (PubChem CID 144536810) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3Z,7Z,12Z)-2,14-dimethyl-5,6,10,11-tetramethylidenepentadeca-1,3,7,12,14-pentaene.
| Compound Name | (3Z,7Z,12Z)-2,14-dimethyl-5,6,10,11-tetramethylidenepentadeca-1,3,7,12,14-pentaene |
|---|---|
| PubChem CID | 144536810 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (3Z,7Z,12Z)-2,14-dimethyl-5,6,10,11-tetramethylidenepentadeca-1,3,7,12,14-pentaene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C\CC(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C21H26/c1-16(2)12-14-20(7)18(5)10-9-11-19(6)21(8)15-13-17(3)4/h9-10,12-15H,1,3,5-8,11H2,2,4H3/b10-9-,14-12-,15-13- |
| InChIKey | OCCDPWIGVKISPN-SYUGFTCTSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|