C9H14O2 — CID 54020800
ethyl 5-methylhexa-3,5-dienoate (PubChem CID 54020800) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is ethyl 5-methylhexa-3,5-dienoate.
| Compound Name | ethyl 5-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 54020800 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | ethyl 5-methylhexa-3,5-dienoate |
| SMILES | C=C(C)C=CCC(=O)OCC |
| InChI | InChI=1S/C9H14O2/c1-4-11-9(10)7-5-6-8(2)3/h5-6H,2,4,7H2,1,3H3 |
| InChIKey | KYUABLSJBGJCJY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|