C8H13BF3O2- — CID 132511403
[(E,2S)-6-ethoxy-6-oxohex-3-en-2-yl]-trifluoroboranuide (PubChem CID 132511403) has the molecular formula C8H13BF3O2- and a molecular weight of 209.00 g/mol. Its IUPAC name is [(E,2S)-6-ethoxy-6-oxohex-3-en-2-yl]-trifluoroboranuide.
| Compound Name | [(E,2S)-6-ethoxy-6-oxohex-3-en-2-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 132511403 |
| Molecular Formula | C8H13BF3O2- |
| Molecular Weight | 209.00 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | [(E,2S)-6-ethoxy-6-oxohex-3-en-2-yl]-trifluoroboranuide |
| SMILES | CCOC(=O)C/C=C/[C@H](C)[B-](F)(F)F |
| InChI | InChI=1S/C8H13BF3O2/c1-3-14-8(13)6-4-5-7(2)9(10,11)12/h4-5,7H,3,6H2,1-2H3/q-1/b5-4+/t7-/m0/s1 |
| InChIKey | HCRJARIDMGQJIT-KPJROHGDSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.00 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|