C14H20BrFO2 — CID 143009375
ethyl (3E,5Z)-8-bromo-5-[(Z)-3-fluoroprop-1-enyl]nona-3,5-dienoate (PubChem CID 143009375) has the molecular formula C14H20BrFO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is ethyl (3E,5Z)-8-bromo-5-[(Z)-3-fluoroprop-1-enyl]nona-3,5-dienoate.
| Compound Name | ethyl (3E,5Z)-8-bromo-5-[(Z)-3-fluoroprop-1-enyl]nona-3,5-dienoate |
|---|---|
| PubChem CID | 143009375 |
| Molecular Formula | C14H20BrFO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | ethyl (3E,5Z)-8-bromo-5-[(Z)-3-fluoroprop-1-enyl]nona-3,5-dienoate |
| SMILES | CCOC(=O)C/C=C/C(/C=C\CF)=C/CC(C)Br |
| InChI | InChI=1S/C14H20BrFO2/c1-3-18-14(17)8-4-6-13(7-5-11-16)10-9-12(2)15/h4-7,10,12H,3,8-9,11H2,1-2H3/b6-4+,7-5-,13-10- |
| InChIKey | VTNSHUFYCFPXHL-RXRHCXFJSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|