C12H20O — CID 59055880
(3E,6E)-8-ethoxy-2,6-dimethylocta-1,3,6-triene (PubChem CID 59055880) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E,6E)-8-ethoxy-2,6-dimethylocta-1,3,6-triene.
| Compound Name | (3E,6E)-8-ethoxy-2,6-dimethylocta-1,3,6-triene |
|---|---|
| PubChem CID | 59055880 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3E,6E)-8-ethoxy-2,6-dimethylocta-1,3,6-triene |
| SMILES | C=C(C)/C=C/C/C(C)=C/COCC |
| InChI | InChI=1S/C12H20O/c1-5-13-10-9-12(4)8-6-7-11(2)3/h6-7,9H,2,5,8,10H2,1,3-4H3/b7-6+,12-9+ |
| InChIKey | DPJYEZRAQVHTAZ-ZICOIJLXSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|