C15H24FNO — CID 166944290
(2E)-N-[(2Z,4E)-6-ethoxy-4-fluorohexa-2,4-dienyl]-3,4-dimethylpenta-2,4-dien-2-amine (PubChem CID 166944290) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is (2E)-N-[(2Z,4E)-6-ethoxy-4-fluorohexa-2,4-dienyl]-3,4-dimethylpenta-2,4-dien-2-amine.
| Compound Name | (2E)-N-[(2Z,4E)-6-ethoxy-4-fluorohexa-2,4-dienyl]-3,4-dimethylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 166944290 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (2E)-N-[(2Z,4E)-6-ethoxy-4-fluorohexa-2,4-dienyl]-3,4-dimethylpenta-2,4-dien-2-amine |
| SMILES | C=C(C)/C(C)=C(\C)NC/C=C\C(F)=C/COCC |
| InChI | InChI=1S/C15H24FNO/c1-6-18-11-9-15(16)8-7-10-17-14(5)13(4)12(2)3/h7-9,17H,2,6,10-11H2,1,3-5H3/b8-7-,14-13+,15-9+ |
| InChIKey | PEUXKTGYVJBIJH-RFUKOCTISA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|