C9H20N2O — CID 169160448
1-N-(2-ethoxyethyl)-1-N'-propan-2-ylethene-1,1-diamine (PubChem CID 169160448) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-N-(2-ethoxyethyl)-1-N'-propan-2-ylethene-1,1-diamine.
| Compound Name | 1-N-(2-ethoxyethyl)-1-N'-propan-2-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 169160448 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1-N-(2-ethoxyethyl)-1-N'-propan-2-ylethene-1,1-diamine |
| SMILES | C=C(NCCOCC)NC(C)C |
| InChI | InChI=1S/C9H20N2O/c1-5-12-7-6-10-9(4)11-8(2)3/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | XJNMLWVINHTKAH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|