C11H19NO — CID 143184494
ethene;N-[(2Z)-4-methylpenta-2,4-dienyl]propanamide (PubChem CID 143184494) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is ethene;N-[(2Z)-4-methylpenta-2,4-dienyl]propanamide.
| Compound Name | ethene;N-[(2Z)-4-methylpenta-2,4-dienyl]propanamide |
|---|---|
| PubChem CID | 143184494 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethene;N-[(2Z)-4-methylpenta-2,4-dienyl]propanamide |
| SMILES | C=C.C=C(C)/C=C\CNC(=O)CC |
| InChI | InChI=1S/C9H15NO.C2H4/c1-4-9(11)10-7-5-6-8(2)3;1-2/h5-6H,2,4,7H2,1,3H3,(H,10,11);1-2H2/b6-5-; |
| InChIKey | UXMNKPNSVVILQB-YSMBQZINSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|