C14H21NO — CID 171821385
N-[(2E)-4-methylpenta-2,4-dienyl]-2-(2-prop-1-enylcyclopropyl)acetamide (PubChem CID 171821385) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[(2E)-4-methylpenta-2,4-dienyl]-2-(2-prop-1-enylcyclopropyl)acetamide.
| Compound Name | N-[(2E)-4-methylpenta-2,4-dienyl]-2-(2-prop-1-enylcyclopropyl)acetamide |
|---|---|
| PubChem CID | 171821385 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[(2E)-4-methylpenta-2,4-dienyl]-2-(2-prop-1-enylcyclopropyl)acetamide |
| SMILES | C=C(C)/C=C/CNC(=O)CC1CC1C=CC |
| InChI | InChI=1S/C14H21NO/c1-4-6-12-9-13(12)10-14(16)15-8-5-7-11(2)3/h4-7,12-13H,2,8-10H2,1,3H3,(H,15,16)/b6-4?,7-5+ |
| InChIKey | IPVJMOWAAOGGMC-PKSVUWDWSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|