C13H21NO3 — CID 154876830
methyl (E)-4-[(2-cyclohexylacetyl)amino]but-2-enoate (PubChem CID 154876830) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl (E)-4-[(2-cyclohexylacetyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(2-cyclohexylacetyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 154876830 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl (E)-4-[(2-cyclohexylacetyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c1-17-13(16)8-5-9-14-12(15)10-11-6-3-2-4-7-11/h5,8,11H,2-4,6-7,9-10H2,1H3,(H,14,15)/b8-5+ |
| InChIKey | IBJBJMGJMUWEIG-VMPITWQZSA-N |
| XLogP | 1.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|