C14H26 — CID 178113371
ethane;ethene;(3Z)-2-methyl-6-methylideneocta-1,3-diene (PubChem CID 178113371) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is ethane;ethene;(3Z)-2-methyl-6-methylideneocta-1,3-diene.
| Compound Name | ethane;ethene;(3Z)-2-methyl-6-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 178113371 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | ethane;ethene;(3Z)-2-methyl-6-methylideneocta-1,3-diene |
| SMILES | C=C.C=C(C)/C=C\CC(=C)CC.CC |
| InChI | InChI=1S/C10H16.C2H6.C2H4/c1-5-10(4)8-6-7-9(2)3;2*1-2/h6-7H,2,4-5,8H2,1,3H3;1-2H3;1-2H2/b7-6-;; |
| InChIKey | JAPXWZFIIURDLY-AQTVDGORSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|