C9H14 — CID 170732271
(3Z)-6-methylideneocta-1,3-diene (PubChem CID 170732271) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is (3Z)-6-methylideneocta-1,3-diene.
| Compound Name | (3Z)-6-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 170732271 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (3Z)-6-methylideneocta-1,3-diene |
| SMILES | C=C/C=C\CC(=C)CC |
| InChI | InChI=1S/C9H14/c1-4-6-7-8-9(3)5-2/h4,6-7H,1,3,5,8H2,2H3/b7-6- |
| InChIKey | TYBKPVKIPGPPAG-SREVYHEPSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|