C8H13NO — CID 155482476
(3E)-N-ethylhexa-3,5-dienamide (PubChem CID 155482476) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3E)-N-ethylhexa-3,5-dienamide.
| Compound Name | (3E)-N-ethylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 155482476 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3E)-N-ethylhexa-3,5-dienamide |
| SMILES | C=C/C=C/CC(=O)NCC |
| InChI | InChI=1S/C8H13NO/c1-3-5-6-7-8(10)9-4-2/h3,5-6H,1,4,7H2,2H3,(H,9,10)/b6-5+ |
| InChIKey | FRTXYNMEJNUJQK-AATRIKPKSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|