C12H20 — CID 142891665
ethane;(3Z,6Z)-4-methylnona-1,3,6,8-tetraene (PubChem CID 142891665) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is ethane;(3Z,6Z)-4-methylnona-1,3,6,8-tetraene.
| Compound Name | ethane;(3Z,6Z)-4-methylnona-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 142891665 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | ethane;(3Z,6Z)-4-methylnona-1,3,6,8-tetraene |
| SMILES | C=C/C=C\C/C(C)=C\C=C.CC |
| InChI | InChI=1S/C10H14.C2H6/c1-4-6-7-9-10(3)8-5-2;1-2/h4-8H,1-2,9H2,3H3;1-2H3/b7-6-,10-8-; |
| InChIKey | OJYNKXLVPQDOTG-GOKMCMDNSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|