C15H24O — CID 143724412
ethane;(3Z)-2-[(3Z)-hexa-1,3-dien-2-yl]oxy-5-methylhexa-1,3,5-triene (PubChem CID 143724412) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;(3Z)-2-[(3Z)-hexa-1,3-dien-2-yl]oxy-5-methylhexa-1,3,5-triene.
| Compound Name | ethane;(3Z)-2-[(3Z)-hexa-1,3-dien-2-yl]oxy-5-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143724412 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | ethane;(3Z)-2-[(3Z)-hexa-1,3-dien-2-yl]oxy-5-methylhexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)OC(=C)/C=C\CC.CC |
| InChI | InChI=1S/C13H18O.C2H6/c1-6-7-8-12(4)14-13(5)10-9-11(2)3;1-2/h7-10H,2,4-6H2,1,3H3;1-2H3/b8-7-,10-9-; |
| InChIKey | OUOWGFZNZBBNLH-CGGPWJJTSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|