C24H38O2 — CID 145045584
ethane;(2E,4Z)-2-[(3Z)-5-[(3Z)-hexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-yl]oxyocta-2,4-diene (PubChem CID 145045584) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-[(3Z)-5-[(3Z)-hexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-yl]oxyocta-2,4-diene.
| Compound Name | ethane;(2E,4Z)-2-[(3Z)-5-[(3Z)-hexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-yl]oxyocta-2,4-diene |
|---|---|
| PubChem CID | 145045584 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | ethane;(2E,4Z)-2-[(3Z)-5-[(3Z)-hexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-yl]oxyocta-2,4-diene |
| SMILES | C=C/C=C\C(=C)OC(=C)/C=C\C(=C)O/C(C)=C/C=C\CCC.CC.CC |
| InChI | InChI=1S/C20H26O2.2C2H6/c1-7-9-11-12-14-18(4)22-20(6)16-15-19(5)21-17(3)13-10-8-2;2*1-2/h8,10-16H,2-3,5-7,9H2,1,4H3;2*1-2H3/b12-11-,13-10-,16-15-,18-14+;; |
| InChIKey | ZBYQHMAQOGSKIG-BDBGZYLVSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|