C10H15NO — CID 130278986
[(3Z)-hexa-1,3,5-trien-2-yl] N-ethylethanimidate (PubChem CID 130278986) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is [(3Z)-hexa-1,3,5-trien-2-yl] N-ethylethanimidate.
| Compound Name | [(3Z)-hexa-1,3,5-trien-2-yl] N-ethylethanimidate |
|---|---|
| PubChem CID | 130278986 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | [(3Z)-hexa-1,3,5-trien-2-yl] N-ethylethanimidate |
| SMILES | C=C/C=C\C(=C)O/C(C)=N/CC |
| InChI | InChI=1S/C10H15NO/c1-5-7-8-9(3)12-10(4)11-6-2/h5,7-8H,1,3,6H2,2,4H3/b8-7-,11-10+ |
| InChIKey | UORFBNZVRFWTPD-QEFCTBRHSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|