C19H32O — CID 143933755
ethane;(3Z,5Z)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-5-methylhepta-1,3,5-triene (PubChem CID 143933755) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is ethane;(3Z,5Z)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-5-methylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143933755 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | ethane;(3Z,5Z)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)OC(=C)/C=C\C(C)=C/C.CC.CC |
| InChI | InChI=1S/C15H20O.2C2H6/c1-6-9-10-15(8-3)16-14(5)12-11-13(4)7-2;2*1-2/h6-12H,1,5H2,2-4H3;2*1-2H3/b10-9-,12-11-,13-7-,15-8+;; |
| InChIKey | NFRWHSMLELTXDN-ZBQUPPPCSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|