C14H28 — CID 142516353
(3Z,5Z)-5-methylhepta-1,3,5-triene;propane (PubChem CID 142516353) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is (3Z,5Z)-5-methylhepta-1,3,5-triene;propane.
| Compound Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;propane |
|---|---|
| PubChem CID | 142516353 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;propane |
| SMILES | C=C/C=C\C(C)=C/C.CCC.CCC |
| InChI | InChI=1S/C8H12.2C3H8/c1-4-6-7-8(3)5-2;2*1-3-2/h4-7H,1H2,2-3H3;2*3H2,1-2H3/b7-6-,8-5-;; |
| InChIKey | MDTGGZOUCKNCHA-SYQAIZLOSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|