C16H23N — CID 143842568
(3Z,5Z)-5-methylhepta-1,3,5-triene;N-methyl-1-phenylmethanamine (PubChem CID 143842568) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (3Z,5Z)-5-methylhepta-1,3,5-triene;N-methyl-1-phenylmethanamine.
| Compound Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 143842568 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;N-methyl-1-phenylmethanamine |
| SMILES | C=C/C=C\C(C)=C/C.CNCc1ccccc1 |
| InChI | InChI=1S/C8H11N.C8H12/c1-9-7-8-5-3-2-4-6-8;1-4-6-7-8(3)5-2/h2-6,9H,7H2,1H3;4-7H,1H2,2-3H3/b;7-6-,8-5- |
| InChIKey | CNAMLRGMNWDZLM-JLMZEHOHSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|