C22H23N — CID 143492954
N-[(1Z,3Z)-2-methylhexa-1,3,5-trienyl]-N-phenyl-4-prop-2-enylaniline (PubChem CID 143492954) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[(1Z,3Z)-2-methylhexa-1,3,5-trienyl]-N-phenyl-4-prop-2-enylaniline.
| Compound Name | N-[(1Z,3Z)-2-methylhexa-1,3,5-trienyl]-N-phenyl-4-prop-2-enylaniline |
|---|---|
| PubChem CID | 143492954 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[(1Z,3Z)-2-methylhexa-1,3,5-trienyl]-N-phenyl-4-prop-2-enylaniline |
| SMILES | C=C/C=C\C(C)=C/N(c1ccccc1)c1ccc(CC=C)cc1 |
| InChI | InChI=1S/C22H23N/c1-4-6-11-19(3)18-23(21-12-8-7-9-13-21)22-16-14-20(10-5-2)15-17-22/h4-9,11-18H,1-2,10H2,3H3/b11-6-,19-18- |
| InChIKey | FENHOBFEEBSJEV-JTWZEKQYSA-N |
| XLogP | 6.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|