C14H16S — CID 144560586
(2E,4Z)-3-benzylhepta-2,4,6-triene-2-thiol (PubChem CID 144560586) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is (2E,4Z)-3-benzylhepta-2,4,6-triene-2-thiol.
| Compound Name | (2E,4Z)-3-benzylhepta-2,4,6-triene-2-thiol |
|---|---|
| PubChem CID | 144560586 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (2E,4Z)-3-benzylhepta-2,4,6-triene-2-thiol |
| SMILES | C=C/C=C\C(Cc1ccccc1)=C(/C)S |
| InChI | InChI=1S/C14H16S/c1-3-4-10-14(12(2)15)11-13-8-6-5-7-9-13/h3-10,15H,1,11H2,2H3/b10-4-,14-12- |
| InChIKey | BMVRXYYKLOVALI-XMTSMWLVSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|