About ethane;2-phenylethanedithioic acid
ethane;2-phenylethanedithioic acid (PubChem CID 144720057) has the molecular formula C10H14S2
and a molecular weight of 198.36 g/mol. Its IUPAC name is ethane;2-phenylethanedithioic acid.
Molecular Properties
| Compound Name | ethane;2-phenylethanedithioic acid |
| PubChem CID | 144720057 |
| Molecular Formula | C10H14S2 |
| Molecular Weight | 198.36 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | ethane;2-phenylethanedithioic acid |
| SMILES | CC.S=C(S)Cc1ccccc1 |
| InChI | InChI=1S/C8H8S2.C2H6/c9-8(10)6-7-4-2-1-3-5-7;1-2/h1-5H,6H2,(H,9,10);1-2H3 |
| InChIKey | RTSAQFCNBYPQRJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-phenylethanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenylethanedithioic acid?
The IUPAC name of ethane;2-phenylethanedithioic acid (CID 144720057) is ethane;2-phenylethanedithioic acid.
What is the SMILES notation for ethane;2-phenylethanedithioic acid?
The canonical SMILES for ethane;2-phenylethanedithioic acid is CC.S=C(S)Cc1ccccc1.
What is the InChIKey of ethane;2-phenylethanedithioic acid?
The InChIKey is RTSAQFCNBYPQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S2.C2H6/c9-8(10)6-7-4-2-1-3-5-7;1-2/h1-5H,6H2,(H,9,10);1-2H3.
What are the key properties of ethane;2-phenylethanedithioic acid?
ethane;2-phenylethanedithioic acid has a molecular weight of 198.36 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenylethanedithioic acid is sourced from PubChem (CID 144720057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).